C24H29NO3 — CID 91762982
N-[(3-hydroxycyclobutyl)-phenylmethyl]-1-(4-methoxyphenyl)cyclopentane-1-carboxamide (PubChem CID 91762982) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)-phenylmethyl]-1-(4-methoxyphenyl)cyclopentane-1-carboxamide.
| Compound Name | N-[(3-hydroxycyclobutyl)-phenylmethyl]-1-(4-methoxyphenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 91762982 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)-phenylmethyl]-1-(4-methoxyphenyl)cyclopentane-1-carboxamide |
| SMILES | COc1ccc(C2(C(=O)NC(c3ccccc3)C3CC(O)C3)CCCC2)cc1 |
| InChI | InChI=1S/C24H29NO3/c1-28-21-11-9-19(10-12-21)24(13-5-6-14-24)23(27)25-22(18-15-20(26)16-18)17-7-3-2-4-8-17/h2-4,7-12,18,20,22,26H,5-6,13-16H2,1H3,(H,25,27) |
| InChIKey | WEPBANYDSYEFCF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |