About 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide
3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide (PubChem CID 91764238) has the molecular formula C15H17N3O3S
and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide |
| PubChem CID | 91764238 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide |
| SMILES | Nc1ccsc1C(=O)N[C@@H]1COCC[C@H]1Oc1ccccn1 |
| InChI | InChI=1S/C15H17N3O3S/c16-10-5-8-22-14(10)15(19)18-11-9-20-7-4-12(11)21-13-3-1-2-6-17-13/h1-3,5-6,8,11-12H,4,7,9,16H2,(H,18,19)/t11-,12-/m1/s1 |
| InChIKey | CDFDXHCAPXMKLG-VXGBXAGGSA-N |
| XLogP | 1.69 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide?
The IUPAC name of 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide (CID 91764238) is 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide.
What is the SMILES notation for 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide?
The canonical SMILES for 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide is Nc1ccsc1C(=O)N[C@@H]1COCC[C@H]1Oc1ccccn1.
What is the InChIKey of 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide?
The InChIKey is CDFDXHCAPXMKLG-VXGBXAGGSA-N. The full InChI is InChI=1S/C15H17N3O3S/c16-10-5-8-22-14(10)15(19)18-11-9-20-7-4-12(11)21-13-3-1-2-6-17-13/h1-3,5-6,8,11-12H,4,7,9,16H2,(H,18,19)/t11-,12-/m1/s1.
What are the key properties of 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide?
3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide has a molecular weight of 319.39 g/mol, XLogP of 1.69, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[(3R,4R)-4-pyridin-2-yloxyoxan-3-yl]thiophene-2-carboxamide is sourced from PubChem (CID 91764238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).