About 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide
2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide (PubChem CID 91764432) has the molecular formula C16H23N3O4S
and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide |
| PubChem CID | 91764432 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide |
| SMILES | O=C(CN1CCCCC1=O)N[C@@H]1CCOC[C@H]1OCc1cscn1 |
| InChI | InChI=1S/C16H23N3O4S/c20-15(7-19-5-2-1-3-16(19)21)18-13-4-6-22-9-14(13)23-8-12-10-24-11-17-12/h10-11,13-14H,1-9H2,(H,18,20)/t13-,14-/m1/s1 |
| InChIKey | JFNUPRSSYXHWOZ-ZIAGYGMSSA-N |
| XLogP | 0.95 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide?
The IUPAC name of 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide (CID 91764432) is 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide.
What is the SMILES notation for 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide?
The canonical SMILES for 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide is O=C(CN1CCCCC1=O)N[C@@H]1CCOC[C@H]1OCc1cscn1.
What is the InChIKey of 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide?
The InChIKey is JFNUPRSSYXHWOZ-ZIAGYGMSSA-N. The full InChI is InChI=1S/C16H23N3O4S/c20-15(7-19-5-2-1-3-16(19)21)18-13-4-6-22-9-14(13)23-8-12-10-24-11-17-12/h10-11,13-14H,1-9H2,(H,18,20)/t13-,14-/m1/s1.
What are the key properties of 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide?
2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide has a molecular weight of 353.44 g/mol, XLogP of 0.95, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxopiperidin-1-yl)-N-[(3S,4R)-3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]acetamide is sourced from PubChem (CID 91764432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).