C12H16F4N2O2S — CID 91764464
N-[(2-ethyl-4-methyl-1,3-thiazol-5-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 91764464) has the molecular formula C12H16F4N2O2S and a molecular weight of 328.33 g/mol. Its IUPAC name is N-[(2-ethyl-4-methyl-1,3-thiazol-5-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-[(2-ethyl-4-methyl-1,3-thiazol-5-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 91764464 |
| Molecular Formula | C12H16F4N2O2S |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-[(2-ethyl-4-methyl-1,3-thiazol-5-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | CCc1nc(C)c(CNC(=O)COCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C12H16F4N2O2S/c1-3-10-18-7(2)8(21-10)4-17-9(19)5-20-6-12(15,16)11(13)14/h11H,3-6H2,1-2H3,(H,17,19) |
| InChIKey | DNRZRSSUJKEOJI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|