About 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide
2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide (PubChem CID 91764988) has the molecular formula C18H25N3O4S
and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide |
| PubChem CID | 91764988 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide |
| SMILES | CCn1nc(C)cc1S(=O)(=O)N[C@@H]1COCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H25N3O4S/c1-3-21-18(11-14(2)19-21)26(22,23)20-16-13-24-10-9-17(16)25-12-15-7-5-4-6-8-15/h4-8,11,16-17,20H,3,9-10,12-13H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | VKSUENVNYRQLFC-SJORKVTESA-N |
| XLogP | 1.86 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide?
The IUPAC name of 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide (CID 91764988) is 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide.
What is the SMILES notation for 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide?
The canonical SMILES for 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide is CCn1nc(C)cc1S(=O)(=O)N[C@@H]1COCC[C@@H]1OCc1ccccc1.
What is the InChIKey of 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide?
The InChIKey is VKSUENVNYRQLFC-SJORKVTESA-N. The full InChI is InChI=1S/C18H25N3O4S/c1-3-21-18(11-14(2)19-21)26(22,23)20-16-13-24-10-9-17(16)25-12-15-7-5-4-6-8-15/h4-8,11,16-17,20H,3,9-10,12-13H2,1-2H3/t16-,17+/m1/s1.
What are the key properties of 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide?
2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide has a molecular weight of 379.48 g/mol, XLogP of 1.86, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]pyrazole-3-sulfonamide is sourced from PubChem (CID 91764988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).