C17H17ClN6O — CID 91765018
N-[(4-chlorophenyl)-pyridin-4-ylmethyl]-3-(5-methyltetrazol-1-yl)propanamide (PubChem CID 91765018) has the molecular formula C17H17ClN6O and a molecular weight of 356.82 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-pyridin-4-ylmethyl]-3-(5-methyltetrazol-1-yl)propanamide.
| Compound Name | N-[(4-chlorophenyl)-pyridin-4-ylmethyl]-3-(5-methyltetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 91765018 |
| Molecular Formula | C17H17ClN6O |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[(4-chlorophenyl)-pyridin-4-ylmethyl]-3-(5-methyltetrazol-1-yl)propanamide |
| SMILES | Cc1nnnn1CCC(=O)NC(c1ccncc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN6O/c1-12-21-22-23-24(12)11-8-16(25)20-17(14-6-9-19-10-7-14)13-2-4-15(18)5-3-13/h2-7,9-10,17H,8,11H2,1H3,(H,20,25) |
| InChIKey | SQKPMWOAHLWNLK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |