About 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide
1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide (PubChem CID 91767285) has the molecular formula C11H17N3O3S
and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide |
| PubChem CID | 91767285 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)N[C@@H]2C[C@@H]3OCC[C@@H]32)cn1 |
| InChI | InChI=1S/C11H17N3O3S/c1-2-14-7-8(6-12-14)18(15,16)13-10-5-11-9(10)3-4-17-11/h6-7,9-11,13H,2-5H2,1H3/t9-,10-,11+/m1/s1 |
| InChIKey | UVLWMVQCXDOGDB-MXWKQRLJSA-N |
| XLogP | 0.36 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide?
The IUPAC name of 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide (CID 91767285) is 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide.
What is the SMILES notation for 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide?
The canonical SMILES for 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide is CCn1cc(S(=O)(=O)N[C@@H]2C[C@@H]3OCC[C@@H]32)cn1.
What is the InChIKey of 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide?
The InChIKey is UVLWMVQCXDOGDB-MXWKQRLJSA-N. The full InChI is InChI=1S/C11H17N3O3S/c1-2-14-7-8(6-12-14)18(15,16)13-10-5-11-9(10)3-4-17-11/h6-7,9-11,13H,2-5H2,1H3/t9-,10-,11+/m1/s1.
What are the key properties of 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide?
1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide has a molecular weight of 271.34 g/mol, XLogP of 0.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-[(1S,5R,6R)-2-oxabicyclo[3.2.0]heptan-6-yl]pyrazole-4-sulfonamide is sourced from PubChem (CID 91767285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).