C14H19F4N5O2 — CID 91767480
1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone (PubChem CID 91767480) has the molecular formula C14H19F4N5O2 and a molecular weight of 365.33 g/mol. Its IUPAC name is 1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone.
| Compound Name | 1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
|---|---|
| PubChem CID | 91767480 |
| Molecular Formula | C14H19F4N5O2 |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-[4-(2-amino-6-methylpyrimidin-4-yl)piperazin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
| SMILES | Cc1cc(N2CCN(C(=O)COCC(F)(F)C(F)F)CC2)nc(N)n1 |
| InChI | InChI=1S/C14H19F4N5O2/c1-9-6-10(21-13(19)20-9)22-2-4-23(5-3-22)11(24)7-25-8-14(17,18)12(15)16/h6,12H,2-5,7-8H2,1H3,(H2,19,20,21) |
| InChIKey | MKUCOJXYGGNWRJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|