C20H26N4O2 — CID 91767492
N-[3-[4-methyl-5-(5,6,7,8-tetrahydronaphthalen-1-yloxymethyl)-1,2,4-triazol-3-yl]cyclobutyl]acetamide (PubChem CID 91767492) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[3-[4-methyl-5-(5,6,7,8-tetrahydronaphthalen-1-yloxymethyl)-1,2,4-triazol-3-yl]cyclobutyl]acetamide.
| Compound Name | N-[3-[4-methyl-5-(5,6,7,8-tetrahydronaphthalen-1-yloxymethyl)-1,2,4-triazol-3-yl]cyclobutyl]acetamide |
|---|---|
| PubChem CID | 91767492 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-[3-[4-methyl-5-(5,6,7,8-tetrahydronaphthalen-1-yloxymethyl)-1,2,4-triazol-3-yl]cyclobutyl]acetamide |
| SMILES | CC(=O)NC1CC(c2nnc(COc3cccc4c3CCCC4)n2C)C1 |
| InChI | InChI=1S/C20H26N4O2/c1-13(25)21-16-10-15(11-16)20-23-22-19(24(20)2)12-26-18-9-5-7-14-6-3-4-8-17(14)18/h5,7,9,15-16H,3-4,6,8,10-12H2,1-2H3,(H,21,25) |
| InChIKey | NDBMFHVZJNFWON-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |