C13H19N7S — CID 91767496
5-[3-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]propyl]-1,3,4-thiadiazol-2-amine (PubChem CID 91767496) has the molecular formula C13H19N7S and a molecular weight of 305.41 g/mol. Its IUPAC name is 5-[3-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]propyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[3-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]propyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 91767496 |
| Molecular Formula | C13H19N7S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 5-[3-[[6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]propyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(CCCNc2cc(C3CC(N)C3)ncn2)s1 |
| InChI | InChI=1S/C13H19N7S/c14-9-4-8(5-9)10-6-11(18-7-17-10)16-3-1-2-12-19-20-13(15)21-12/h6-9H,1-5,14H2,(H2,15,20)(H,16,17,18) |
| InChIKey | VEYSLEVJFNGTKV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|