C21H28N2O3 — CID 91768162
N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-3-(1H-indol-3-yl)propanamide (PubChem CID 91768162) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 91768162 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-[(3R,4S)-4-(cyclobutylmethoxy)oxan-3-yl]-3-(1H-indol-3-yl)propanamide |
| SMILES | O=C(CCc1c[nH]c2ccccc12)N[C@@H]1COCC[C@@H]1OCC1CCC1 |
| InChI | InChI=1S/C21H28N2O3/c24-21(9-8-16-12-22-18-7-2-1-6-17(16)18)23-19-14-25-11-10-20(19)26-13-15-4-3-5-15/h1-2,6-7,12,15,19-20,22H,3-5,8-11,13-14H2,(H,23,24)/t19-,20+/m1/s1 |
| InChIKey | NXBAIWPCOWREHC-UXHICEINSA-N |
| XLogP | 3.19 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |