C19H25ClN4O2 — CID 91768240
6-(3-aminocyclobutyl)-N-[2-(2-chloro-6-methylphenoxy)ethyl]-2-(methoxymethyl)pyrimidin-4-amine (PubChem CID 91768240) has the molecular formula C19H25ClN4O2 and a molecular weight of 376.89 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-N-[2-(2-chloro-6-methylphenoxy)ethyl]-2-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 6-(3-aminocyclobutyl)-N-[2-(2-chloro-6-methylphenoxy)ethyl]-2-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 91768240 |
| Molecular Formula | C19H25ClN4O2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 6-(3-aminocyclobutyl)-N-[2-(2-chloro-6-methylphenoxy)ethyl]-2-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCc1nc(NCCOc2c(C)cccc2Cl)cc(C2CC(N)C2)n1 |
| InChI | InChI=1S/C19H25ClN4O2/c1-12-4-3-5-15(20)19(12)26-7-6-22-17-10-16(13-8-14(21)9-13)23-18(24-17)11-25-2/h3-5,10,13-14H,6-9,11,21H2,1-2H3,(H,22,23,24) |
| InChIKey | MRHNIIGJGBHLRP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|