C16H29N5O — CID 91768318
2-[methyl-(1-methylpiperidin-4-yl)amino]-N-(4-pyrazol-1-ylbutan-2-yl)acetamide (PubChem CID 91768318) has the molecular formula C16H29N5O and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[methyl-(1-methylpiperidin-4-yl)amino]-N-(4-pyrazol-1-ylbutan-2-yl)acetamide.
| Compound Name | 2-[methyl-(1-methylpiperidin-4-yl)amino]-N-(4-pyrazol-1-ylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 91768318 |
| Molecular Formula | C16H29N5O |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | 2-[methyl-(1-methylpiperidin-4-yl)amino]-N-(4-pyrazol-1-ylbutan-2-yl)acetamide |
| SMILES | CC(CCn1cccn1)NC(=O)CN(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C16H29N5O/c1-14(5-12-21-9-4-8-17-21)18-16(22)13-20(3)15-6-10-19(2)11-7-15/h4,8-9,14-15H,5-7,10-13H2,1-3H3,(H,18,22) |
| InChIKey | JJJAQZIOVDUUIL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |