About 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide
4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide (PubChem CID 91768638) has the molecular formula C17H20ClN3O3
and a molecular weight of 349.82 g/mol. Its IUPAC name is 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide |
| PubChem CID | 91768638 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)N[C@@H]2COCC[C@@H]2OCc2ccccc2)c1Cl |
| InChI | InChI=1S/C17H20ClN3O3/c1-11-15(18)16(21-20-11)17(22)19-13-10-23-8-7-14(13)24-9-12-5-3-2-4-6-12/h2-6,13-14H,7-10H2,1H3,(H,19,22)(H,20,21)/t13-,14+/m1/s1 |
| InChIKey | JVWQZYDZNVDYDP-KGLIPLIRSA-N |
| XLogP | 2.48 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide?
The IUPAC name of 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide (CID 91768638) is 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide?
The canonical SMILES for 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide is Cc1[nH]nc(C(=O)N[C@@H]2COCC[C@@H]2OCc2ccccc2)c1Cl.
What is the InChIKey of 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide?
The InChIKey is JVWQZYDZNVDYDP-KGLIPLIRSA-N. The full InChI is InChI=1S/C17H20ClN3O3/c1-11-15(18)16(21-20-11)17(22)19-13-10-23-8-7-14(13)24-9-12-5-3-2-4-6-12/h2-6,13-14H,7-10H2,1H3,(H,19,22)(H,20,21)/t13-,14+/m1/s1.
What are the key properties of 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide?
4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide has a molecular weight of 349.82 g/mol, XLogP of 2.48, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 91768638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).