C19H30N4O2 — CID 91768691
N-cyclopentyl-3-[2-[cyclopropyl(hydroxy)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]propanamide (PubChem CID 91768691) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-cyclopentyl-3-[2-[cyclopropyl(hydroxy)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]propanamide.
| Compound Name | N-cyclopentyl-3-[2-[cyclopropyl(hydroxy)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]propanamide |
|---|---|
| PubChem CID | 91768691 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N-cyclopentyl-3-[2-[cyclopropyl(hydroxy)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]propanamide |
| SMILES | O=C(CCN1CCCn2nc(C(O)C3CC3)cc2C1)NC1CCCC1 |
| InChI | InChI=1S/C19H30N4O2/c24-18(20-15-4-1-2-5-15)8-11-22-9-3-10-23-16(13-22)12-17(21-23)19(25)14-6-7-14/h12,14-15,19,25H,1-11,13H2,(H,20,24) |
| InChIKey | ZMRVDLIUTKCIKF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |