C17H19N3O6 — CID 91768835
2-[(3R,4S)-3-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]oxan-4-yl]oxyacetic acid (PubChem CID 91768835) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]oxan-4-yl]oxyacetic acid.
| Compound Name | 2-[(3R,4S)-3-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]oxan-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 91768835 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[(3R,4S)-3-[[2-(4-oxoquinazolin-3-yl)acetyl]amino]oxan-4-yl]oxyacetic acid |
| SMILES | O=C(O)CO[C@H]1CCOC[C@H]1NC(=O)Cn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C17H19N3O6/c21-15(19-13-8-25-6-5-14(13)26-9-16(22)23)7-20-10-18-12-4-2-1-3-11(12)17(20)24/h1-4,10,13-14H,5-9H2,(H,19,21)(H,22,23)/t13-,14+/m1/s1 |
| InChIKey | TWECIXVSZUDVDQ-KGLIPLIRSA-N |
| XLogP | -0.23 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |