C13H20N2O3 — CID 91768875
N-[(3S,4R)-3-hydroxyoxan-4-yl]-1,2,5-trimethylpyrrole-3-carboxamide (PubChem CID 91768875) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is N-[(3S,4R)-3-hydroxyoxan-4-yl]-1,2,5-trimethylpyrrole-3-carboxamide.
| Compound Name | N-[(3S,4R)-3-hydroxyoxan-4-yl]-1,2,5-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 91768875 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-[(3S,4R)-3-hydroxyoxan-4-yl]-1,2,5-trimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H]2CCOC[C@H]2O)c(C)n1C |
| InChI | InChI=1S/C13H20N2O3/c1-8-6-10(9(2)15(8)3)13(17)14-11-4-5-18-7-12(11)16/h6,11-12,16H,4-5,7H2,1-3H3,(H,14,17)/t11-,12-/m1/s1 |
| InChIKey | ZEMQVIZKFNQZCE-VXGBXAGGSA-N |
| XLogP | 0.52 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |