C20H26N8 — CID 91769754
3-[4-methyl-5-[(3-phenyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl)methyl]-1,2,4-triazol-3-yl]cyclobutan-1-amine (PubChem CID 91769754) has the molecular formula C20H26N8 and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-[4-methyl-5-[(3-phenyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl)methyl]-1,2,4-triazol-3-yl]cyclobutan-1-amine.
| Compound Name | 3-[4-methyl-5-[(3-phenyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl)methyl]-1,2,4-triazol-3-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 91769754 |
| Molecular Formula | C20H26N8 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 3-[4-methyl-5-[(3-phenyl-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl)methyl]-1,2,4-triazol-3-yl]cyclobutan-1-amine |
| SMILES | Cn1c(CN2CCc3nnc(-c4ccccc4)n3CC2)nnc1C1CC(N)C1 |
| InChI | InChI=1S/C20H26N8/c1-26-18(23-24-19(26)15-11-16(21)12-15)13-27-8-7-17-22-25-20(28(17)10-9-27)14-5-3-2-4-6-14/h2-6,15-16H,7-13,21H2,1H3 |
| InChIKey | KWNBWQZDGOFGIZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |