C19H16F2N4O4 — CID 9176981
N-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 9176981) has the molecular formula C19H16F2N4O4 and a molecular weight of 402.36 g/mol. Its IUPAC name is N-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9176981 |
| Molecular Formula | C19H16F2N4O4 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[(Z)-[4-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2n[nH]c(=O)c3ccccc23)ccc1OC(F)F |
| InChI | InChI=1S/C19H16F2N4O4/c1-2-28-15-9-11(7-8-14(15)29-19(20)21)10-22-24-18(27)16-12-5-3-4-6-13(12)17(26)25-23-16/h3-10,19H,2H2,1H3,(H,24,27)(H,25,26)/b22-10- |
| InChIKey | UROITDRHZHCWJL-YVNNLAQVSA-N |
| XLogP | 2.69 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|