About 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine
5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 91769836) has the molecular formula C18H27FN4O3
and a molecular weight of 366.44 g/mol. Its IUPAC name is 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine |
| PubChem CID | 91769836 |
| Molecular Formula | C18H27FN4O3 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | CC(C)=CCO[C@H]1CCOC[C@H]1Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H27FN4O3/c1-13(2)3-8-26-16-4-7-25-12-15(16)21-18-20-11-14(19)17(22-18)23-5-9-24-10-6-23/h3,11,15-16H,4-10,12H2,1-2H3,(H,20,21,22)/t15-,16+/m1/s1 |
| InChIKey | RAGCSJYNGMYUTK-CVEARBPZSA-N |
| XLogP | 2.00 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine?
The IUPAC name of 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine (CID 91769836) is 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine.
What is the SMILES notation for 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine?
The canonical SMILES for 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine is CC(C)=CCO[C@H]1CCOC[C@H]1Nc1ncc(F)c(N2CCOCC2)n1.
What is the InChIKey of 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine?
The InChIKey is RAGCSJYNGMYUTK-CVEARBPZSA-N. The full InChI is InChI=1S/C18H27FN4O3/c1-13(2)3-8-26-16-4-7-25-12-15(16)21-18-20-11-14(19)17(22-18)23-5-9-24-10-6-23/h3,11,15-16H,4-10,12H2,1-2H3,(H,20,21,22)/t15-,16+/m1/s1.
What are the key properties of 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine?
5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine has a molecular weight of 366.44 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-[(3R,4S)-4-(3-methylbut-2-enoxy)oxan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine is sourced from PubChem (CID 91769836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).