C18H26N6O3 — CID 91770844
N-[3-[5-(hydroxymethyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]cyclobutyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 91770844) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[3-[5-(hydroxymethyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]cyclobutyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[3-[5-(hydroxymethyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]cyclobutyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 91770844 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-[3-[5-(hydroxymethyl)-4-(2-methoxyethyl)-1,2,4-triazol-3-yl]cyclobutyl]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | COCCn1c(CO)nnc1C1CC(NC(=O)c2n[nH]c3c2CCCC3)C1 |
| InChI | InChI=1S/C18H26N6O3/c1-27-7-6-24-15(10-25)21-23-17(24)11-8-12(9-11)19-18(26)16-13-4-2-3-5-14(13)20-22-16/h11-12,25H,2-10H2,1H3,(H,19,26)(H,20,22) |
| InChIKey | HCRHIRIVMZIIJE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |