C11H15F4N3O2 — CID 91771454
N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 91771454) has the molecular formula C11H15F4N3O2 and a molecular weight of 297.25 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 91771454 |
| Molecular Formula | C11H15F4N3O2 |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | Cc1[nH]ncc1CN(C)C(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H15F4N3O2/c1-7-8(3-16-17-7)4-18(2)9(19)5-20-6-11(14,15)10(12)13/h3,10H,4-6H2,1-2H3,(H,16,17) |
| InChIKey | MNFUQUZBJORYJU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|