C14H15N5O2 — CID 91771728
1-(4-methoxyphenyl)-4-(1,3,5-triazin-2-ylamino)pyrrolidin-2-one (PubChem CID 91771728) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-(1,3,5-triazin-2-ylamino)pyrrolidin-2-one.
| Compound Name | 1-(4-methoxyphenyl)-4-(1,3,5-triazin-2-ylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 91771728 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-(1,3,5-triazin-2-ylamino)pyrrolidin-2-one |
| SMILES | COc1ccc(N2CC(Nc3ncncn3)CC2=O)cc1 |
| InChI | InChI=1S/C14H15N5O2/c1-21-12-4-2-11(3-5-12)19-7-10(6-13(19)20)18-14-16-8-15-9-17-14/h2-5,8-10H,6-7H2,1H3,(H,15,16,17,18) |
| InChIKey | HJMRGKXNRJSJQU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |