C24H31N3O — CID 91772427
1-benzyl-4-phenyl-N-[[(2S)-pyrrolidin-2-yl]methyl]piperidine-4-carboxamide (PubChem CID 91772427) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-benzyl-4-phenyl-N-[[(2S)-pyrrolidin-2-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-benzyl-4-phenyl-N-[[(2S)-pyrrolidin-2-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91772427 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 1-benzyl-4-phenyl-N-[[(2S)-pyrrolidin-2-yl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCN1)C1(c2ccccc2)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H31N3O/c28-23(26-18-22-12-7-15-25-22)24(21-10-5-2-6-11-21)13-16-27(17-14-24)19-20-8-3-1-4-9-20/h1-6,8-11,22,25H,7,12-19H2,(H,26,28)/t22-/m0/s1 |
| InChIKey | ZJYBEJUOPPYFNX-QFIPXVFZSA-N |
| XLogP | 3.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |