C17H26N4O3 — CID 91772642
N-[(1-acetylpiperidin-3-yl)methyl]-6-tert-butyl-2-oxo-1H-pyrimidine-4-carboxamide (PubChem CID 91772642) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(1-acetylpiperidin-3-yl)methyl]-6-tert-butyl-2-oxo-1H-pyrimidine-4-carboxamide.
| Compound Name | N-[(1-acetylpiperidin-3-yl)methyl]-6-tert-butyl-2-oxo-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 91772642 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[(1-acetylpiperidin-3-yl)methyl]-6-tert-butyl-2-oxo-1H-pyrimidine-4-carboxamide |
| SMILES | CC(=O)N1CCCC(CNC(=O)c2cc(C(C)(C)C)[nH]c(=O)n2)C1 |
| InChI | InChI=1S/C17H26N4O3/c1-11(22)21-7-5-6-12(10-21)9-18-15(23)13-8-14(17(2,3)4)20-16(24)19-13/h8,12H,5-7,9-10H2,1-4H3,(H,18,23)(H,19,20,24) |
| InChIKey | YOWKTSVPMMCOLW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |