C19H22N2O2 — CID 91773593
N-[(3-hydroxycyclobutyl)-pyridin-2-ylmethyl]-3,4-dimethylbenzamide (PubChem CID 91773593) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)-pyridin-2-ylmethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[(3-hydroxycyclobutyl)-pyridin-2-ylmethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 91773593 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)-pyridin-2-ylmethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(c2ccccn2)C2CC(O)C2)cc1C |
| InChI | InChI=1S/C19H22N2O2/c1-12-6-7-14(9-13(12)2)19(23)21-18(15-10-16(22)11-15)17-5-3-4-8-20-17/h3-9,15-16,18,22H,10-11H2,1-2H3,(H,21,23) |
| InChIKey | PLUUGAJUZBLQTO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |