C18H25F3N2O — CID 91774516
N-[[1-(2-methylpropyl)pyrrolidin-3-yl]methyl]-2-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 91774516) has the molecular formula C18H25F3N2O and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[[1-(2-methylpropyl)pyrrolidin-3-yl]methyl]-2-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[[1-(2-methylpropyl)pyrrolidin-3-yl]methyl]-2-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 91774516 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[[1-(2-methylpropyl)pyrrolidin-3-yl]methyl]-2-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)CN1CCC(CNC(=O)Cc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C18H25F3N2O/c1-13(2)11-23-8-7-14(12-23)10-22-17(24)9-15-5-3-4-6-16(15)18(19,20)21/h3-6,13-14H,7-12H2,1-2H3,(H,22,24) |
| InChIKey | MFTCNOYOWBNQKK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |