About 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide
2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide (PubChem CID 91774576) has the molecular formula C14H19ClFNO5S
and a molecular weight of 367.83 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide |
| PubChem CID | 91774576 |
| Molecular Formula | C14H19ClFNO5S |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@@H]2CCOC[C@H]2OCCO)c(Cl)cc1F |
| InChI | InChI=1S/C14H19ClFNO5S/c1-9-6-14(10(15)7-11(9)16)23(19,20)17-12-2-4-21-8-13(12)22-5-3-18/h6-7,12-13,17-18H,2-5,8H2,1H3/t12-,13-/m1/s1 |
| InChIKey | MITDUMFZRLVVJJ-CHWSQXEVSA-N |
| XLogP | 1.23 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide?
The IUPAC name of 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide (CID 91774576) is 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide.
What is the SMILES notation for 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide?
The canonical SMILES for 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide is Cc1cc(S(=O)(=O)N[C@@H]2CCOC[C@H]2OCCO)c(Cl)cc1F.
What is the InChIKey of 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide?
The InChIKey is MITDUMFZRLVVJJ-CHWSQXEVSA-N. The full InChI is InChI=1S/C14H19ClFNO5S/c1-9-6-14(10(15)7-11(9)16)23(19,20)17-12-2-4-21-8-13(12)22-5-3-18/h6-7,12-13,17-18H,2-5,8H2,1H3/t12-,13-/m1/s1.
What are the key properties of 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide?
2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide has a molecular weight of 367.83 g/mol, XLogP of 1.23, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-fluoro-N-[(3S,4R)-3-(2-hydroxyethoxy)oxan-4-yl]-5-methylbenzenesulfonamide is sourced from PubChem (CID 91774576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).