About 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine
4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine (PubChem CID 91774901) has the molecular formula C19H20N4O2
and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine.
Molecular Properties
| Compound Name | 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine |
| PubChem CID | 91774901 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine |
| SMILES | Cc1nnc(N[C@@H]2CCOC[C@H]2Oc2ccccn2)c2ccccc12 |
| InChI | InChI=1S/C19H20N4O2/c1-13-14-6-2-3-7-15(14)19(23-22-13)21-16-9-11-24-12-17(16)25-18-8-4-5-10-20-18/h2-8,10,16-17H,9,11-12H2,1H3,(H,21,23)/t16-,17-/m1/s1 |
| InChIKey | XMHRATQYKXHWFM-IAGOWNOFSA-N |
| XLogP | 2.98 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine?
The IUPAC name of 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine (CID 91774901) is 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine.
What is the SMILES notation for 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine?
The canonical SMILES for 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine is Cc1nnc(N[C@@H]2CCOC[C@H]2Oc2ccccn2)c2ccccc12.
What is the InChIKey of 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine?
The InChIKey is XMHRATQYKXHWFM-IAGOWNOFSA-N. The full InChI is InChI=1S/C19H20N4O2/c1-13-14-6-2-3-7-15(14)19(23-22-13)21-16-9-11-24-12-17(16)25-18-8-4-5-10-20-18/h2-8,10,16-17H,9,11-12H2,1H3,(H,21,23)/t16-,17-/m1/s1.
What are the key properties of 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine?
4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine has a molecular weight of 336.39 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[(3S,4R)-3-pyridin-2-yloxyoxan-4-yl]phthalazin-1-amine is sourced from PubChem (CID 91774901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).