C14H20N4O — CID 91774953
2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]acetamide (PubChem CID 91774953) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]acetamide.
| Compound Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 91774953 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[2-(2-methyl-1,2,4-triazol-3-yl)ethyl]acetamide |
| SMILES | Cn1ncnc1CCNC(=O)C[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H20N4O/c1-18-13(16-9-17-18)4-5-15-14(19)8-12-7-10-2-3-11(12)6-10/h2-3,9-12H,4-8H2,1H3,(H,15,19)/t10-,11+,12+/m1/s1 |
| InChIKey | DMAYDAGUCVSLAG-WOPDTQHZSA-N |
| XLogP | 1.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|