C17H23NO3 — CID 9177518
1'-butyl-5',7'-dimethylspiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 9177518) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1'-butyl-5',7'-dimethylspiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-butyl-5',7'-dimethylspiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 9177518 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1'-butyl-5',7'-dimethylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CCCCN1C(=O)C2(OCCCO2)c2cc(C)cc(C)c21 |
| InChI | InChI=1S/C17H23NO3/c1-4-5-7-18-15-13(3)10-12(2)11-14(15)17(16(18)19)20-8-6-9-21-17/h10-11H,4-9H2,1-3H3 |
| InChIKey | NULQSORVZXAHNW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |