About 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one
5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 9177572) has the molecular formula C14H16BrNO3
and a molecular weight of 326.19 g/mol. Its IUPAC name is 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| PubChem CID | 9177572 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CC(C)N1C(=O)C2(OCCCO2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H16BrNO3/c1-9(2)16-12-5-4-10(15)8-11(12)14(13(16)17)18-6-3-7-19-14/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | HOCGZSBPIQDZRD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one?
The IUPAC name of 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one (CID 9177572) is 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one.
What is the SMILES notation for 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one?
The canonical SMILES for 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one is CC(C)N1C(=O)C2(OCCCO2)c2cc(Br)ccc21.
What is the InChIKey of 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one?
The InChIKey is HOCGZSBPIQDZRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrNO3/c1-9(2)16-12-5-4-10(15)8-11(12)14(13(16)17)18-6-3-7-19-14/h4-5,8-9H,3,6-7H2,1-2H3.
What are the key properties of 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one?
5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one has a molecular weight of 326.19 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-bromo-1'-propan-2-ylspiro[1,3-dioxane-2,3'-indole]-2'-one is sourced from PubChem (CID 9177572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).