About 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one
1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 9177608) has the molecular formula C21H20ClNO5
and a molecular weight of 401.85 g/mol. Its IUPAC name is 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one |
| PubChem CID | 9177608 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CC(=O)c1ccc(OCCN2C(=O)C3(OCCCO3)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C21H20ClNO5/c1-14(24)15-3-6-17(7-4-15)26-12-9-23-19-8-5-16(22)13-18(19)21(20(23)25)27-10-2-11-28-21/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | HOGYXARUBMBIOB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one?
The IUPAC name of 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one (CID 9177608) is 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one.
What is the SMILES notation for 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one?
The canonical SMILES for 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one is CC(=O)c1ccc(OCCN2C(=O)C3(OCCCO3)c3cc(Cl)ccc32)cc1.
What is the InChIKey of 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one?
The InChIKey is HOGYXARUBMBIOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20ClNO5/c1-14(24)15-3-6-17(7-4-15)26-12-9-23-19-8-5-16(22)13-18(19)21(20(23)25)27-10-2-11-28-21/h3-8,13H,2,9-12H2,1H3.
What are the key properties of 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one?
1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one has a molecular weight of 401.85 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[2-(4-acetylphenoxy)ethyl]-5'-chlorospiro[1,3-dioxane-2,3'-indole]-2'-one is sourced from PubChem (CID 9177608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).