C13H13Cl2NO3 — CID 9177663
4',7'-dichloro-1'-ethylspiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 9177663) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is 4',7'-dichloro-1'-ethylspiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 4',7'-dichloro-1'-ethylspiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 9177663 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4',7'-dichloro-1'-ethylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CCN1C(=O)C2(OCCCO2)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C13H13Cl2NO3/c1-2-16-11-9(15)5-4-8(14)10(11)13(12(16)17)18-6-3-7-19-13/h4-5H,2-3,6-7H2,1H3 |
| InChIKey | CEFZREZGNFCXMW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |