C19H23NO3 — CID 91776792
N-[(1S,5S,6R,7R)-7-cyclopentyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-oxo-2-phenylacetamide (PubChem CID 91776792) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[(1S,5S,6R,7R)-7-cyclopentyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-oxo-2-phenylacetamide.
| Compound Name | N-[(1S,5S,6R,7R)-7-cyclopentyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-oxo-2-phenylacetamide |
|---|---|
| PubChem CID | 91776792 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[(1S,5S,6R,7R)-7-cyclopentyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-oxo-2-phenylacetamide |
| SMILES | O=C(N[C@@H]1[C@@H]2CCO[C@@H]2[C@@H]1C1CCCC1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23NO3/c21-17(13-8-2-1-3-9-13)19(22)20-16-14-10-11-23-18(14)15(16)12-6-4-5-7-12/h1-3,8-9,12,14-16,18H,4-7,10-11H2,(H,20,22)/t14-,15+,16+,18-/m0/s1 |
| InChIKey | LXISMSBWOJPEAO-LHHMISFZSA-N |
| XLogP | 2.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|