C12H15F3N2OS — CID 91776840
4,4,4-trifluoro-N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)butanamide (PubChem CID 91776840) has the molecular formula C12H15F3N2OS and a molecular weight of 292.33 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)butanamide.
| Compound Name | 4,4,4-trifluoro-N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)butanamide |
|---|---|
| PubChem CID | 91776840 |
| Molecular Formula | C12H15F3N2OS |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4,4,4-trifluoro-N-(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)butanamide |
| SMILES | Cc1nc2c(s1)CCCC2NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C12H15F3N2OS/c1-7-16-11-8(3-2-4-9(11)19-7)17-10(18)5-6-12(13,14)15/h8H,2-6H2,1H3,(H,17,18) |
| InChIKey | OVMPJBVUMXFGMZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |