About 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one
5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 9177725) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| PubChem CID | 9177725 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | C=CCN1C(=O)C2(OCCCO2)c2cc(CCCC)ccc21 |
| InChI | InChI=1S/C18H23NO3/c1-3-5-7-14-8-9-16-15(13-14)18(21-11-6-12-22-18)17(20)19(16)10-4-2/h4,8-9,13H,2-3,5-7,10-12H2,1H3 |
| InChIKey | JTCNBVSINDILSB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one?
The IUPAC name of 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one (CID 9177725) is 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one.
What is the SMILES notation for 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one?
The canonical SMILES for 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one is C=CCN1C(=O)C2(OCCCO2)c2cc(CCCC)ccc21.
What is the InChIKey of 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one?
The InChIKey is JTCNBVSINDILSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO3/c1-3-5-7-14-8-9-16-15(13-14)18(21-11-6-12-22-18)17(20)19(16)10-4-2/h4,8-9,13H,2-3,5-7,10-12H2,1H3.
What are the key properties of 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one?
5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one has a molecular weight of 301.39 g/mol, XLogP of 3.15, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-butyl-1'-prop-2-enylspiro[1,3-dioxane-2,3'-indole]-2'-one is sourced from PubChem (CID 9177725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).