C15H15F3N4OS — CID 91777835
N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-pyridin-2-ylsulfanylacetamide (PubChem CID 91777835) has the molecular formula C15H15F3N4OS and a molecular weight of 356.37 g/mol. Its IUPAC name is N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 91777835 |
| Molecular Formula | C15H15F3N4OS |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-pyridin-2-ylsulfanylacetamide |
| SMILES | Cc1cc(C(F)(F)F)nc(CCNC(=O)CSc2ccccn2)n1 |
| InChI | InChI=1S/C15H15F3N4OS/c1-10-8-11(15(16,17)18)22-12(21-10)5-7-19-13(23)9-24-14-4-2-3-6-20-14/h2-4,6,8H,5,7,9H2,1H3,(H,19,23) |
| InChIKey | IUUSOTIIAYKYJU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |