About N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide
N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide (PubChem CID 91778242) has the molecular formula C16H24N2O4
and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide |
| PubChem CID | 91778242 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide |
| SMILES | CCc1ocnc1C(=O)N[C@@H]1CCOC[C@H]1OCC1CCC1 |
| InChI | InChI=1S/C16H24N2O4/c1-2-13-15(17-10-22-13)16(19)18-12-6-7-20-9-14(12)21-8-11-4-3-5-11/h10-12,14H,2-9H2,1H3,(H,18,19)/t12-,14-/m1/s1 |
| InChIKey | SHARHBHDKUNSET-TZMCWYRMSA-N |
| XLogP | 1.94 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide?
The IUPAC name of N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide (CID 91778242) is N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide is CCc1ocnc1C(=O)N[C@@H]1CCOC[C@H]1OCC1CCC1.
What is the InChIKey of N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide?
The InChIKey is SHARHBHDKUNSET-TZMCWYRMSA-N. The full InChI is InChI=1S/C16H24N2O4/c1-2-13-15(17-10-22-13)16(19)18-12-6-7-20-9-14(12)21-8-11-4-3-5-11/h10-12,14H,2-9H2,1H3,(H,18,19)/t12-,14-/m1/s1.
What are the key properties of N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide?
N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide has a molecular weight of 308.38 g/mol, XLogP of 1.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4R)-3-(cyclobutylmethoxy)oxan-4-yl]-5-ethyl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 91778242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).