C14H15N3O2 — CID 91778285
N-[(1S,5R,6S)-2-oxabicyclo[3.2.0]heptan-6-yl]-1H-indazole-3-carboxamide (PubChem CID 91778285) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-[(1S,5R,6S)-2-oxabicyclo[3.2.0]heptan-6-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[(1S,5R,6S)-2-oxabicyclo[3.2.0]heptan-6-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 91778285 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[(1S,5R,6S)-2-oxabicyclo[3.2.0]heptan-6-yl]-1H-indazole-3-carboxamide |
| SMILES | O=C(N[C@H]1C[C@@H]2OCC[C@H]12)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C14H15N3O2/c18-14(15-11-7-12-8(11)5-6-19-12)13-9-3-1-2-4-10(9)16-17-13/h1-4,8,11-12H,5-7H2,(H,15,18)(H,16,17)/t8-,11+,12+/m1/s1 |
| InChIKey | QHSYHELADIYRKG-ZHAHWJHGSA-N |
| XLogP | 1.47 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |