About methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate
methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate (PubChem CID 91778665) has the molecular formula C13H20N4O3S2
and a molecular weight of 344.46 g/mol. Its IUPAC name is methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate |
| PubChem CID | 91778665 |
| Molecular Formula | C13H20N4O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCCC1C(=O)NCCSc1nnc(C)s1 |
| InChI | InChI=1S/C13H20N4O3S2/c1-9-15-16-12(22-9)21-8-6-14-11(18)10-5-3-4-7-17(10)13(19)20-2/h10H,3-8H2,1-2H3,(H,14,18) |
| InChIKey | FQEXZKXFHFMPCN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate?
The IUPAC name of methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate (CID 91778665) is methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate.
What is the SMILES notation for methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate?
The canonical SMILES for methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate is COC(=O)N1CCCCC1C(=O)NCCSc1nnc(C)s1.
What is the InChIKey of methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate?
The InChIKey is FQEXZKXFHFMPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O3S2/c1-9-15-16-12(22-9)21-8-6-14-11(18)10-5-3-4-7-17(10)13(19)20-2/h10H,3-8H2,1-2H3,(H,14,18).
What are the key properties of methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate?
methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate has a molecular weight of 344.46 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylcarbamoyl]piperidine-1-carboxylate is sourced from PubChem (CID 91778665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).