About methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate
methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate (PubChem CID 91778668) has the molecular formula C11H19N5O3
and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate |
| PubChem CID | 91778668 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate |
| SMILES | CCCn1cnnc1CNC(=O)C(C)NC(=O)OC |
| InChI | InChI=1S/C11H19N5O3/c1-4-5-16-7-13-15-9(16)6-12-10(17)8(2)14-11(18)19-3/h7-8H,4-6H2,1-3H3,(H,12,17)(H,14,18) |
| InChIKey | HMPGUFVKNSFPQG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate?
The IUPAC name of methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate (CID 91778668) is methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate.
What is the SMILES notation for methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate?
The canonical SMILES for methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate is CCCn1cnnc1CNC(=O)C(C)NC(=O)OC.
What is the InChIKey of methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate?
The InChIKey is HMPGUFVKNSFPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O3/c1-4-5-16-7-13-15-9(16)6-12-10(17)8(2)14-11(18)19-3/h7-8H,4-6H2,1-3H3,(H,12,17)(H,14,18).
What are the key properties of methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate?
methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate has a molecular weight of 269.30 g/mol, XLogP of 0.05, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1-oxo-1-[(4-propyl-1,2,4-triazol-3-yl)methylamino]propan-2-yl]carbamate is sourced from PubChem (CID 91778668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).