C18H22N4O4 — CID 91779283
N-[(1R,5S,6R,7R)-7-ethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-1,7-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 91779283) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[(1R,5S,6R,7R)-7-ethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-1,7-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-[(1R,5S,6R,7R)-7-ethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-1,7-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 91779283 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[(1R,5S,6R,7R)-7-ethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-1,7-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CC[C@@H]1[C@@H](NC(=O)c2cc(C)nc3c2c(=O)[nH]c(=O)n3C)[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C18H22N4O4/c1-4-9-13(10-5-6-26-14(9)10)20-16(23)11-7-8(2)19-15-12(11)17(24)21-18(25)22(15)3/h7,9-10,13-14H,4-6H2,1-3H3,(H,20,23)(H,21,24,25)/t9-,10+,13-,14-/m1/s1 |
| InChIKey | AVGAQVCAWNAWJY-RDBQEKCUSA-N |
| XLogP | 0.47 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |