About 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide
2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide (PubChem CID 91779438) has the molecular formula C16H23N3O4S
and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide |
| PubChem CID | 91779438 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide |
| SMILES | CN(C)CCO[C@@H]1COCC[C@H]1NS(=O)(=O)c1ccccc1C#N |
| InChI | InChI=1S/C16H23N3O4S/c1-19(2)8-10-23-15-12-22-9-7-14(15)18-24(20,21)16-6-4-3-5-13(16)11-17/h3-6,14-15,18H,7-10,12H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | LRYXRHDWYARVQR-HUUCEWRRSA-N |
| XLogP | 0.57 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide?
The IUPAC name of 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide (CID 91779438) is 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide.
What is the SMILES notation for 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide?
The canonical SMILES for 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide is CN(C)CCO[C@@H]1COCC[C@H]1NS(=O)(=O)c1ccccc1C#N.
What is the InChIKey of 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide?
The InChIKey is LRYXRHDWYARVQR-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H23N3O4S/c1-19(2)8-10-23-15-12-22-9-7-14(15)18-24(20,21)16-6-4-3-5-13(16)11-17/h3-6,14-15,18H,7-10,12H2,1-2H3/t14-,15-/m1/s1.
What are the key properties of 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide?
2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide has a molecular weight of 353.44 g/mol, XLogP of 0.57, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]benzenesulfonamide is sourced from PubChem (CID 91779438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).