C22H23NO4 — CID 9177951
4',7'-dimethyl-1'-[(2-prop-2-enoxyphenyl)methyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 9177951) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4',7'-dimethyl-1'-[(2-prop-2-enoxyphenyl)methyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | 4',7'-dimethyl-1'-[(2-prop-2-enoxyphenyl)methyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 9177951 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4',7'-dimethyl-1'-[(2-prop-2-enoxyphenyl)methyl]spiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | C=CCOc1ccccc1CN1C(=O)C2(OCCO2)c2c(C)ccc(C)c21 |
| InChI | InChI=1S/C22H23NO4/c1-4-11-25-18-8-6-5-7-17(18)14-23-20-16(3)10-9-15(2)19(20)22(21(23)24)26-12-13-27-22/h4-10H,1,11-14H2,2-3H3 |
| InChIKey | VBORUDMCAQDQSU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|