About 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide
2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide (PubChem CID 91779643) has the molecular formula C12H20N4O3
and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide |
| PubChem CID | 91779643 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide |
| SMILES | CCO[C@H]1CN(CC(=O)Nc2cnn(C)c2)C[C@@H]1O |
| InChI | InChI=1S/C12H20N4O3/c1-3-19-11-7-16(6-10(11)17)8-12(18)14-9-4-13-15(2)5-9/h4-5,10-11,17H,3,6-8H2,1-2H3,(H,14,18)/t10-,11-/m0/s1 |
| InChIKey | VKCBCXURGHAFBQ-QWRGUYRKSA-N |
| XLogP | -0.56 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide?
The IUPAC name of 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide (CID 91779643) is 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide.
What is the SMILES notation for 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide?
The canonical SMILES for 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide is CCO[C@H]1CN(CC(=O)Nc2cnn(C)c2)C[C@@H]1O.
What is the InChIKey of 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide?
The InChIKey is VKCBCXURGHAFBQ-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H20N4O3/c1-3-19-11-7-16(6-10(11)17)8-12(18)14-9-4-13-15(2)5-9/h4-5,10-11,17H,3,6-8H2,1-2H3,(H,14,18)/t10-,11-/m0/s1.
What are the key properties of 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide?
2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide has a molecular weight of 268.32 g/mol, XLogP of -0.56, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-N-(1-methylpyrazol-4-yl)acetamide is sourced from PubChem (CID 91779643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).