C15H17F4NO4 — CID 91779696
[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 91779696) has the molecular formula C15H17F4NO4 and a molecular weight of 351.30 g/mol. Its IUPAC name is [(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | [(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 91779696 |
| Molecular Formula | C15H17F4NO4 |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | CCO[C@H]1CN(C(=O)c2ccccc2OC(F)(F)C(F)F)C[C@@H]1O |
| InChI | InChI=1S/C15H17F4NO4/c1-2-23-12-8-20(7-10(12)21)13(22)9-5-3-4-6-11(9)24-15(18,19)14(16)17/h3-6,10,12,14,21H,2,7-8H2,1H3/t10-,12-/m0/s1 |
| InChIKey | NFZJKFDAUNMZDB-JQWIXIFHSA-N |
| XLogP | 2.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|