C22H25NO5 — CID 9177985
1'-[3-(4-methoxyphenoxy)propyl]-4',7'-dimethylspiro[1,3-dioxolane-2,3'-indole]-2'-one (PubChem CID 9177985) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 1'-[3-(4-methoxyphenoxy)propyl]-4',7'-dimethylspiro[1,3-dioxolane-2,3'-indole]-2'-one.
| Compound Name | 1'-[3-(4-methoxyphenoxy)propyl]-4',7'-dimethylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 9177985 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1'-[3-(4-methoxyphenoxy)propyl]-4',7'-dimethylspiro[1,3-dioxolane-2,3'-indole]-2'-one |
| SMILES | COc1ccc(OCCCN2C(=O)C3(OCCO3)c3c(C)ccc(C)c32)cc1 |
| InChI | InChI=1S/C22H25NO5/c1-15-5-6-16(2)20-19(15)22(27-13-14-28-22)21(24)23(20)11-4-12-26-18-9-7-17(25-3)8-10-18/h5-10H,4,11-14H2,1-3H3 |
| InChIKey | AQAGRQSJCLADIP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|