C17H20N2O3S — CID 91780050
3-(benzenesulfonyl)-N-(3-pyridin-2-ylpropyl)propanamide (PubChem CID 91780050) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(3-pyridin-2-ylpropyl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(3-pyridin-2-ylpropyl)propanamide |
|---|---|
| PubChem CID | 91780050 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(3-pyridin-2-ylpropyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)NCCCc1ccccn1 |
| InChI | InChI=1S/C17H20N2O3S/c20-17(19-13-6-8-15-7-4-5-12-18-15)11-14-23(21,22)16-9-2-1-3-10-16/h1-5,7,9-10,12H,6,8,11,13-14H2,(H,19,20) |
| InChIKey | BVSJHFJIIXXPML-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|