About N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide
N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide (PubChem CID 91780543) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide.
Molecular Properties
| Compound Name | N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide |
| PubChem CID | 91780543 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide |
| SMILES | CN(C)CCO[C@@H]1COCC[C@H]1NC(=O)C1CC=CC1 |
| InChI | InChI=1S/C15H26N2O3/c1-17(2)8-10-20-14-11-19-9-7-13(14)16-15(18)12-5-3-4-6-12/h3-4,12-14H,5-11H2,1-2H3,(H,16,18)/t13-,14-/m1/s1 |
| InChIKey | PDWFVLNYGNMZKY-ZIAGYGMSSA-N |
| XLogP | 0.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide?
The IUPAC name of N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide (CID 91780543) is N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide.
What is the SMILES notation for N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide?
The canonical SMILES for N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide is CN(C)CCO[C@@H]1COCC[C@H]1NC(=O)C1CC=CC1.
What is the InChIKey of N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide?
The InChIKey is PDWFVLNYGNMZKY-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-17(2)8-10-20-14-11-19-9-7-13(14)16-15(18)12-5-3-4-6-12/h3-4,12-14H,5-11H2,1-2H3,(H,16,18)/t13-,14-/m1/s1.
What are the key properties of N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide?
N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide has a molecular weight of 282.38 g/mol, XLogP of 0.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4R)-3-[2-(dimethylamino)ethoxy]oxan-4-yl]cyclopent-3-ene-1-carboxamide is sourced from PubChem (CID 91780543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).